C9H8N2O3S — CID 24976169
ethyl 3-(1,3-thiazol-4-yl)-1,2-oxazole-5-carboxylate (PubChem CID 24976169) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is ethyl 3-(1,3-thiazol-4-yl)-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 3-(1,3-thiazol-4-yl)-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 24976169 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | ethyl 3-(1,3-thiazol-4-yl)-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cscn2)no1 |
| InChI | InChI=1S/C9H8N2O3S/c1-2-13-9(12)8-3-6(11-14-8)7-4-15-5-10-7/h3-5H,2H2,1H3 |
| InChIKey | IOYUTSPNZPDRKD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |