C14H9F3N2O6S — CID 59518212
ethyl 3-[3-isocyano-4-(trifluoromethylsulfonyloxy)phenyl]-1,2-oxazole-5-carboxylate (PubChem CID 59518212) has the molecular formula C14H9F3N2O6S and a molecular weight of 390.30 g/mol. Its IUPAC name is ethyl 3-[3-isocyano-4-(trifluoromethylsulfonyloxy)phenyl]-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 3-[3-isocyano-4-(trifluoromethylsulfonyloxy)phenyl]-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 59518212 |
| Molecular Formula | C14H9F3N2O6S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | ethyl 3-[3-isocyano-4-(trifluoromethylsulfonyloxy)phenyl]-1,2-oxazole-5-carboxylate |
| SMILES | [C-]#[N+]c1cc(-c2cc(C(=O)OCC)on2)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H9F3N2O6S/c1-3-23-13(20)12-7-9(19-24-12)8-4-5-11(10(6-8)18-2)25-26(21,22)14(15,16)17/h4-7H,3H2,1H3 |
| InChIKey | HSRKLXVIFLINKK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 100.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|