C14H13F3N2O5S — CID 88573602
ethyl 3-(4-methylphenyl)-4-(trifluoromethylsulfonyloxy)-1H-pyrazole-5-carboxylate (PubChem CID 88573602) has the molecular formula C14H13F3N2O5S and a molecular weight of 378.33 g/mol. Its IUPAC name is ethyl 3-(4-methylphenyl)-4-(trifluoromethylsulfonyloxy)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-(4-methylphenyl)-4-(trifluoromethylsulfonyloxy)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 88573602 |
| Molecular Formula | C14H13F3N2O5S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | ethyl 3-(4-methylphenyl)-4-(trifluoromethylsulfonyloxy)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]nc(-c2ccc(C)cc2)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O5S/c1-3-23-13(20)11-12(24-25(21,22)14(15,16)17)10(18-19-11)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3,(H,18,19) |
| InChIKey | HIPVEGGERGCBRH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|