C18H12F6O10S4 — CID 132516731
diethyl 3,7-bis(trifluoromethylsulfonyloxy)thieno[2,3-f][1]benzothiole-2,6-dicarboxylate (PubChem CID 132516731) has the molecular formula C18H12F6O10S4 and a molecular weight of 630.54 g/mol. Its IUPAC name is diethyl 3,7-bis(trifluoromethylsulfonyloxy)thieno[2,3-f][1]benzothiole-2,6-dicarboxylate.
| Compound Name | diethyl 3,7-bis(trifluoromethylsulfonyloxy)thieno[2,3-f][1]benzothiole-2,6-dicarboxylate |
|---|---|
| PubChem CID | 132516731 |
| Molecular Formula | C18H12F6O10S4 |
| Molecular Weight | 630.54 g/mol |
| Exact Mass | 629.92 |
| IUPAC Name | diethyl 3,7-bis(trifluoromethylsulfonyloxy)thieno[2,3-f][1]benzothiole-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1sc2cc3c(OS(=O)(=O)C(F)(F)F)c(C(=O)OCC)sc3cc2c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H12F6O10S4/c1-3-31-15(25)13-11(33-37(27,28)17(19,20)21)7-5-10-8(6-9(7)35-13)12(14(36-10)16(26)32-4-2)34-38(29,30)18(22,23)24/h5-6H,3-4H2,1-2H3 |
| InChIKey | PTZRFZKHERRUNC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|