C16H12F3NO5S3 — CID 87319654
ethyl 4-methyl-2-[7-(trifluoromethylsulfonyloxy)-1-benzothiophen-5-yl]-1,3-thiazole-5-carboxylate (PubChem CID 87319654) has the molecular formula C16H12F3NO5S3 and a molecular weight of 451.47 g/mol. Its IUPAC name is ethyl 4-methyl-2-[7-(trifluoromethylsulfonyloxy)-1-benzothiophen-5-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[7-(trifluoromethylsulfonyloxy)-1-benzothiophen-5-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 87319654 |
| Molecular Formula | C16H12F3NO5S3 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 450.98 |
| IUPAC Name | ethyl 4-methyl-2-[7-(trifluoromethylsulfonyloxy)-1-benzothiophen-5-yl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2cc(OS(=O)(=O)C(F)(F)F)c3sccc3c2)nc1C |
| InChI | InChI=1S/C16H12F3NO5S3/c1-3-24-15(21)12-8(2)20-14(27-12)10-6-9-4-5-26-13(9)11(7-10)25-28(22,23)16(17,18)19/h4-7H,3H2,1-2H3 |
| InChIKey | WVADIRORTWEXJU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|