C13H7F3N2O5S2 — CID 151263613
2-[3-cyano-4-(trifluoromethylsulfonyloxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 151263613) has the molecular formula C13H7F3N2O5S2 and a molecular weight of 392.34 g/mol. Its IUPAC name is 2-[3-cyano-4-(trifluoromethylsulfonyloxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[3-cyano-4-(trifluoromethylsulfonyloxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 151263613 |
| Molecular Formula | C13H7F3N2O5S2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 2-[3-cyano-4-(trifluoromethylsulfonyloxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2ccc(OS(=O)(=O)C(F)(F)F)c(C#N)c2)sc1C(=O)O |
| InChI | InChI=1S/C13H7F3N2O5S2/c1-6-10(12(19)20)24-11(18-6)7-2-3-9(8(4-7)5-17)23-25(21,22)13(14,15)16/h2-4H,1H3,(H,19,20) |
| InChIKey | NUWFDPVVMKPDPC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|