C18H21NO2SSi — CID 23563115
ethyl 4-methyl-2-[4-(2-trimethylsilylethynyl)phenyl]-1,3-thiazole-5-carboxylate (PubChem CID 23563115) has the molecular formula C18H21NO2SSi and a molecular weight of 343.52 g/mol. Its IUPAC name is ethyl 4-methyl-2-[4-(2-trimethylsilylethynyl)phenyl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[4-(2-trimethylsilylethynyl)phenyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 23563115 |
| Molecular Formula | C18H21NO2SSi |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl 4-methyl-2-[4-(2-trimethylsilylethynyl)phenyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(C#C[Si](C)(C)C)cc2)nc1C |
| InChI | InChI=1S/C18H21NO2SSi/c1-6-21-18(20)16-13(2)19-17(22-16)15-9-7-14(8-10-15)11-12-23(3,4)5/h7-10H,6H2,1-5H3 |
| InChIKey | RBGAJLLGIYEQDO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|