C16H17NO5S — CID 149293605
diethyl 2-(4-methoxyphenyl)-1,3-thiazole-4,5-dicarboxylate (PubChem CID 149293605) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is diethyl 2-(4-methoxyphenyl)-1,3-thiazole-4,5-dicarboxylate.
| Compound Name | diethyl 2-(4-methoxyphenyl)-1,3-thiazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 149293605 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | diethyl 2-(4-methoxyphenyl)-1,3-thiazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(OC)cc2)sc1C(=O)OCC |
| InChI | InChI=1S/C16H17NO5S/c1-4-21-15(18)12-13(16(19)22-5-2)23-14(17-12)10-6-8-11(20-3)9-7-10/h6-9H,4-5H2,1-3H3 |
| InChIKey | XVIONWSQAMYVOH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |