C14H13NO4S — CID 136701775
ethyl 5-acetyl-2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 136701775) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is ethyl 5-acetyl-2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-acetyl-2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 136701775 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | ethyl 5-acetyl-2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(O)cc2)sc1C(C)=O |
| InChI | InChI=1S/C14H13NO4S/c1-3-19-14(18)11-12(8(2)16)20-13(15-11)9-4-6-10(17)7-5-9/h4-7,17H,3H2,1-2H3 |
| InChIKey | RPXGYUWOYWVEEL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |