C13H11NO5S — CID 136889058
methyl 5-acetyl-2-(3,4-dihydroxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 136889058) has the molecular formula C13H11NO5S and a molecular weight of 293.30 g/mol. Its IUPAC name is methyl 5-acetyl-2-(3,4-dihydroxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-acetyl-2-(3,4-dihydroxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 136889058 |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | methyl 5-acetyl-2-(3,4-dihydroxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(O)c(O)c2)sc1C(C)=O |
| InChI | InChI=1S/C13H11NO5S/c1-6(15)11-10(13(18)19-2)14-12(20-11)7-3-4-8(16)9(17)5-7/h3-5,16-17H,1-2H3 |
| InChIKey | IEJHGRJSSUIWQS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|