C14H15F3O7S — CID 91205025
ethyl 3-[3,5-dimethoxy-4-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoate (PubChem CID 91205025) has the molecular formula C14H15F3O7S and a molecular weight of 384.33 g/mol. Its IUPAC name is ethyl 3-[3,5-dimethoxy-4-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3,5-dimethoxy-4-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91205025 |
| Molecular Formula | C14H15F3O7S |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | ethyl 3-[3,5-dimethoxy-4-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(OC)c(OS(=O)(=O)C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C14H15F3O7S/c1-4-23-12(18)6-5-9-7-10(21-2)13(11(8-9)22-3)24-25(19,20)14(15,16)17/h5-8H,4H2,1-3H3 |
| InChIKey | LKRFDALDRXTBGM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|