C13H14O5 — CID 169480785
4-(3-ethoxy-3-oxoprop-1-enyl)-2-methoxybenzoic acid (PubChem CID 169480785) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-(3-ethoxy-3-oxoprop-1-enyl)-2-methoxybenzoic acid.
| Compound Name | 4-(3-ethoxy-3-oxoprop-1-enyl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 169480785 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-(3-ethoxy-3-oxoprop-1-enyl)-2-methoxybenzoic acid |
| SMILES | CCOC(=O)C=Cc1ccc(C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C13H14O5/c1-3-18-12(14)7-5-9-4-6-10(13(15)16)11(8-9)17-2/h4-8H,3H2,1-2H3,(H,15,16) |
| InChIKey | DBIPSMSMWBGVPP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|