C10H7F3N2O5S2 — CID 134202450
ethyl 7-(trifluoromethylsulfonyloxy)-[1,3]thiazolo[4,5-c]pyridine-6-carboxylate (PubChem CID 134202450) has the molecular formula C10H7F3N2O5S2 and a molecular weight of 356.30 g/mol. Its IUPAC name is ethyl 7-(trifluoromethylsulfonyloxy)-[1,3]thiazolo[4,5-c]pyridine-6-carboxylate.
| Compound Name | ethyl 7-(trifluoromethylsulfonyloxy)-[1,3]thiazolo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 134202450 |
| Molecular Formula | C10H7F3N2O5S2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | ethyl 7-(trifluoromethylsulfonyloxy)-[1,3]thiazolo[4,5-c]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1ncc2ncsc2c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O5S2/c1-2-19-9(16)6-7(20-22(17,18)10(11,12)13)8-5(3-14-6)15-4-21-8/h3-4H,2H2,1H3 |
| InChIKey | NWUJMVBACHKRGC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|