C7H7F3N2O5S — CID 154321389
ethyl 3-(trifluoromethylsulfonyloxy)-1H-pyrazole-5-carboxylate (PubChem CID 154321389) has the molecular formula C7H7F3N2O5S and a molecular weight of 288.20 g/mol. Its IUPAC name is ethyl 3-(trifluoromethylsulfonyloxy)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-(trifluoromethylsulfonyloxy)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 154321389 |
| Molecular Formula | C7H7F3N2O5S |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | ethyl 3-(trifluoromethylsulfonyloxy)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(OS(=O)(=O)C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C7H7F3N2O5S/c1-2-16-6(13)4-3-5(12-11-4)17-18(14,15)7(8,9)10/h3H,2H2,1H3,(H,11,12) |
| InChIKey | VAADXWYAOJNROK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|