C11H6F9NO5S — CID 10048578
ethyl 2,4-bis(trifluoromethyl)-6-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate (PubChem CID 10048578) has the molecular formula C11H6F9NO5S and a molecular weight of 435.22 g/mol. Its IUPAC name is ethyl 2,4-bis(trifluoromethyl)-6-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate.
| Compound Name | ethyl 2,4-bis(trifluoromethyl)-6-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10048578 |
| Molecular Formula | C11H6F9NO5S |
| Molecular Weight | 435.22 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | ethyl 2,4-bis(trifluoromethyl)-6-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)cc(OS(=O)(=O)C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C11H6F9NO5S/c1-2-25-8(22)6-4(9(12,13)14)3-5(21-7(6)10(15,16)17)26-27(23,24)11(18,19)20/h3H,2H2,1H3 |
| InChIKey | APWPBFDYQIBJMZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|