C10H6ClF6NO2 — CID 10336213
ethyl 6-chloro-2,4-bis(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 10336213) has the molecular formula C10H6ClF6NO2 and a molecular weight of 321.60 g/mol. Its IUPAC name is ethyl 6-chloro-2,4-bis(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-2,4-bis(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10336213 |
| Molecular Formula | C10H6ClF6NO2 |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | ethyl 6-chloro-2,4-bis(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)cc(Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C10H6ClF6NO2/c1-2-20-8(19)6-4(9(12,13)14)3-5(11)18-7(6)10(15,16)17/h3H,2H2,1H3 |
| InChIKey | WTZCQEPMMNVOAB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|