C12H13F6NO3Si — CID 10406262
methyl 2,4-bis(trifluoromethyl)-6-trimethylsilyloxypyridine-3-carboxylate (PubChem CID 10406262) has the molecular formula C12H13F6NO3Si and a molecular weight of 361.31 g/mol. Its IUPAC name is methyl 2,4-bis(trifluoromethyl)-6-trimethylsilyloxypyridine-3-carboxylate.
| Compound Name | methyl 2,4-bis(trifluoromethyl)-6-trimethylsilyloxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 10406262 |
| Molecular Formula | C12H13F6NO3Si |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | methyl 2,4-bis(trifluoromethyl)-6-trimethylsilyloxypyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)(F)F)cc(O[Si](C)(C)C)nc1C(F)(F)F |
| InChI | InChI=1S/C12H13F6NO3Si/c1-21-10(20)8-6(11(13,14)15)5-7(22-23(2,3)4)19-9(8)12(16,17)18/h5H,1-4H3 |
| InChIKey | ZUNMSUWQDVPIKY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|