About lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate
lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate (PubChem CID 10086622) has the molecular formula C10H6F6LiNO3
and a molecular weight of 309.09 g/mol. Its IUPAC name is lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate.
Molecular Properties
| Compound Name | lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate |
| PubChem CID | 10086622 |
| Molecular Formula | C10H6F6LiNO3 |
| Molecular Weight | 309.09 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate |
| SMILES | COC(=O)c1c(C(F)(F)F)[c-]c(OC)nc1C(F)(F)F.[Li+] |
| InChI | InChI=1S/C10H6F6NO3.Li/c1-19-5-3-4(9(11,12)13)6(8(18)20-2)7(17-5)10(14,15)16;/h1-2H3;/q-1;+1 |
| InChIKey | SYMMIOGEOAGXMY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.09 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate?
The IUPAC name of lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate (CID 10086622) is lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate.
What is the SMILES notation for lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate?
The canonical SMILES for lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate is COC(=O)c1c(C(F)(F)F)[c-]c(OC)nc1C(F)(F)F.[Li+].
What is the InChIKey of lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate?
The InChIKey is SYMMIOGEOAGXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F6NO3.Li/c1-19-5-3-4(9(11,12)13)6(8(18)20-2)7(17-5)10(14,15)16;/h1-2H3;/q-1;+1.
What are the key properties of lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate?
lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate has a molecular weight of 309.09 g/mol, XLogP of -0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium methyl 2-methoxy-4,6-bis(trifluoromethyl)-3H-pyridin-3-ide-5-carboxylate is sourced from PubChem (CID 10086622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).