C11H9BrF5NO2 — CID 15117644
methyl 5-bromo-6-(difluoromethyl)-4-ethyl-2-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 15117644) has the molecular formula C11H9BrF5NO2 and a molecular weight of 362.09 g/mol. Its IUPAC name is methyl 5-bromo-6-(difluoromethyl)-4-ethyl-2-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-bromo-6-(difluoromethyl)-4-ethyl-2-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 15117644 |
| Molecular Formula | C11H9BrF5NO2 |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | methyl 5-bromo-6-(difluoromethyl)-4-ethyl-2-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CCc1c(Br)c(C(F)F)nc(C(F)(F)F)c1C(=O)OC |
| InChI | InChI=1S/C11H9BrF5NO2/c1-3-4-5(10(19)20-2)8(11(15,16)17)18-7(6(4)12)9(13)14/h9H,3H2,1-2H3 |
| InChIKey | PACYFAVLBODUKB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |