C12H9F5N2O4 — CID 88600985
4-(aziridin-1-yl)-6-(difluoromethyl)-5-methoxycarbonyl-2-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 88600985) has the molecular formula C12H9F5N2O4 and a molecular weight of 340.20 g/mol. Its IUPAC name is 4-(aziridin-1-yl)-6-(difluoromethyl)-5-methoxycarbonyl-2-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 4-(aziridin-1-yl)-6-(difluoromethyl)-5-methoxycarbonyl-2-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 88600985 |
| Molecular Formula | C12H9F5N2O4 |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-(aziridin-1-yl)-6-(difluoromethyl)-5-methoxycarbonyl-2-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | COC(=O)c1c(C(F)F)nc(C(F)(F)F)c(C(=O)O)c1N1CC1 |
| InChI | InChI=1S/C12H9F5N2O4/c1-23-11(22)4-6(9(13)14)18-8(12(15,16)17)5(10(20)21)7(4)19-2-3-19/h9H,2-3H2,1H3,(H,20,21) |
| InChIKey | BPUDQUPIGQMBDR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|