C14H12ClF5N2O4 — CID 14013797
5-O-ethyl 3-O-methyl 4-(aziridin-1-yl)-2-[chloro(difluoro)methyl]-6-(trifluoromethyl)pyridine-3,5-dicarboxylate (PubChem CID 14013797) has the molecular formula C14H12ClF5N2O4 and a molecular weight of 402.70 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 4-(aziridin-1-yl)-2-[chloro(difluoro)methyl]-6-(trifluoromethyl)pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 4-(aziridin-1-yl)-2-[chloro(difluoro)methyl]-6-(trifluoromethyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14013797 |
| Molecular Formula | C14H12ClF5N2O4 |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 4-(aziridin-1-yl)-2-[chloro(difluoro)methyl]-6-(trifluoromethyl)pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)nc(C(F)(F)Cl)c(C(=O)OC)c1N1CC1 |
| InChI | InChI=1S/C14H12ClF5N2O4/c1-3-26-12(24)7-8(22-4-5-22)6(11(23)25-2)9(13(15,16)17)21-10(7)14(18,19)20/h3-5H2,1-2H3 |
| InChIKey | JFKJAINHSOOONT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|