C15H14ClF5N2O4 — CID 14013828
5-O-ethyl 3-O-methyl 2-[chloro(difluoro)methyl]-4-(2-methylaziridin-1-yl)-6-(trifluoromethyl)pyridine-3,5-dicarboxylate (PubChem CID 14013828) has the molecular formula C15H14ClF5N2O4 and a molecular weight of 416.73 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2-[chloro(difluoro)methyl]-4-(2-methylaziridin-1-yl)-6-(trifluoromethyl)pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2-[chloro(difluoro)methyl]-4-(2-methylaziridin-1-yl)-6-(trifluoromethyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14013828 |
| Molecular Formula | C15H14ClF5N2O4 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2-[chloro(difluoro)methyl]-4-(2-methylaziridin-1-yl)-6-(trifluoromethyl)pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)nc(C(F)(F)Cl)c(C(=O)OC)c1N1CC1C |
| InChI | InChI=1S/C15H14ClF5N2O4/c1-4-27-13(25)8-9(23-5-6(23)2)7(12(24)26-3)10(14(16,17)18)22-11(8)15(19,20)21/h6H,4-5H2,1-3H3 |
| InChIKey | JPKGQEUHOZDYMO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|