C16H16ClF5N2O4 — CID 151089233
diethyl 2-chloro-4-[cyclopropyl(difluoromethyl)amino]-6-(trifluoromethyl)pyridine-3,5-dicarboxylate (PubChem CID 151089233) has the molecular formula C16H16ClF5N2O4 and a molecular weight of 430.76 g/mol. Its IUPAC name is diethyl 2-chloro-4-[cyclopropyl(difluoromethyl)amino]-6-(trifluoromethyl)pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-chloro-4-[cyclopropyl(difluoromethyl)amino]-6-(trifluoromethyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 151089233 |
| Molecular Formula | C16H16ClF5N2O4 |
| Molecular Weight | 430.76 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | diethyl 2-chloro-4-[cyclopropyl(difluoromethyl)amino]-6-(trifluoromethyl)pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(Cl)nc(C(F)(F)F)c(C(=O)OCC)c1N(C(F)F)C1CC1 |
| InChI | InChI=1S/C16H16ClF5N2O4/c1-3-27-13(25)8-10(24(15(18)19)7-5-6-7)9(14(26)28-4-2)12(17)23-11(8)16(20,21)22/h7,15H,3-6H2,1-2H3 |
| InChIKey | MLTVBQIZIBIHLI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|