C13H13F5N2O3 — CID 57214668
ethyl 6-(difluoromethyl)-5-(methoxymethylideneamino)-4-methyl-2-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 57214668) has the molecular formula C13H13F5N2O3 and a molecular weight of 340.25 g/mol. Its IUPAC name is ethyl 6-(difluoromethyl)-5-(methoxymethylideneamino)-4-methyl-2-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(difluoromethyl)-5-(methoxymethylideneamino)-4-methyl-2-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 57214668 |
| Molecular Formula | C13H13F5N2O3 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | ethyl 6-(difluoromethyl)-5-(methoxymethylideneamino)-4-methyl-2-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)nc(C(F)F)c(/N=C/OC)c1C |
| InChI | InChI=1S/C13H13F5N2O3/c1-4-23-12(21)7-6(2)8(19-5-22-3)9(11(14)15)20-10(7)13(16,17)18/h5,11H,4H2,1-3H3/b19-5+ |
| InChIKey | DWZMTPXPAWBOHJ-PTXOJBNSSA-N |
| XLogP | 3.83 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|