C9H7F6N3O2 — CID 86657667
ethyl 3-amino-5,6-bis(trifluoromethyl)pyrazine-2-carboxylate (PubChem CID 86657667) has the molecular formula C9H7F6N3O2 and a molecular weight of 303.16 g/mol. Its IUPAC name is ethyl 3-amino-5,6-bis(trifluoromethyl)pyrazine-2-carboxylate.
| Compound Name | ethyl 3-amino-5,6-bis(trifluoromethyl)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 86657667 |
| Molecular Formula | C9H7F6N3O2 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | ethyl 3-amino-5,6-bis(trifluoromethyl)pyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(F)(F)F)c(C(F)(F)F)nc1N |
| InChI | InChI=1S/C9H7F6N3O2/c1-2-20-7(19)3-6(16)18-5(9(13,14)15)4(17-3)8(10,11)12/h2H2,1H3,(H2,16,18) |
| InChIKey | ABXBYOXXOQGISX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |