About ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate
ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate (PubChem CID 105481585) has the molecular formula C7H7F3N2O3
and a molecular weight of 224.14 g/mol. Its IUPAC name is ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate.
Analyze ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate (CID 105481585) is ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate is CCOC(=O)c1noc(N)c1C(F)(F)F.
What is the InChIKey of ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate?
The InChIKey is ZCQPWLXIPUMJOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O3/c1-2-14-6(13)4-3(7(8,9)10)5(11)15-12-4/h2,11H2,1H3.
What are the key properties of ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate?
ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate has a molecular weight of 224.14 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-4-(trifluoromethyl)-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 105481585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).