C10H16N2O3 — CID 105465922
ethyl 5-amino-4-tert-butyl-1,2-oxazole-3-carboxylate (PubChem CID 105465922) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl 5-amino-4-tert-butyl-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-amino-4-tert-butyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 105465922 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethyl 5-amino-4-tert-butyl-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(N)c1C(C)(C)C |
| InChI | InChI=1S/C10H16N2O3/c1-5-14-9(13)7-6(10(2,3)4)8(11)15-12-7/h5,11H2,1-4H3 |
| InChIKey | GNKOXPZPAMLVRL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |