C10H17N2O6P — CID 15311882
ethyl 5-amino-3-diethoxyphosphoryl-1,2-oxazole-4-carboxylate (PubChem CID 15311882) has the molecular formula C10H17N2O6P and a molecular weight of 292.23 g/mol. Its IUPAC name is ethyl 5-amino-3-diethoxyphosphoryl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-amino-3-diethoxyphosphoryl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 15311882 |
| Molecular Formula | C10H17N2O6P |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | ethyl 5-amino-3-diethoxyphosphoryl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(P(=O)(OCC)OCC)noc1N |
| InChI | InChI=1S/C10H17N2O6P/c1-4-15-10(13)7-8(11)18-12-9(7)19(14,16-5-2)17-6-3/h4-6,11H2,1-3H3 |
| InChIKey | ZEFDLTHQQJPFEF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|