C16H24N3O5P — CID 10642822
ethyl 8-diethoxyphosphoryl-2,3,6-trimethylpyrrolo[1,2-b][1,2,4]triazine-7-carboxylate (PubChem CID 10642822) has the molecular formula C16H24N3O5P and a molecular weight of 369.36 g/mol. Its IUPAC name is ethyl 8-diethoxyphosphoryl-2,3,6-trimethylpyrrolo[1,2-b][1,2,4]triazine-7-carboxylate.
| Compound Name | ethyl 8-diethoxyphosphoryl-2,3,6-trimethylpyrrolo[1,2-b][1,2,4]triazine-7-carboxylate |
|---|---|
| PubChem CID | 10642822 |
| Molecular Formula | C16H24N3O5P |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | ethyl 8-diethoxyphosphoryl-2,3,6-trimethylpyrrolo[1,2-b][1,2,4]triazine-7-carboxylate |
| SMILES | CCOC(=O)c1c(P(=O)(OCC)OCC)c2nc(C)c(C)nn2c1C |
| InChI | InChI=1S/C16H24N3O5P/c1-7-22-16(20)13-12(6)19-15(17-10(4)11(5)18-19)14(13)25(21,23-8-2)24-9-3/h7-9H2,1-6H3 |
| InChIKey | HADZDMHUUVNXHS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|