C7H8Br2N2O2 — CID 24799526
ethyl 3,5-dibromo-1-methylpyrazole-4-carboxylate (PubChem CID 24799526) has the molecular formula C7H8Br2N2O2 and a molecular weight of 311.96 g/mol. Its IUPAC name is ethyl 3,5-dibromo-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 3,5-dibromo-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 24799526 |
| Molecular Formula | C7H8Br2N2O2 |
| Molecular Weight | 311.96 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | ethyl 3,5-dibromo-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(Br)nn(C)c1Br |
| InChI | InChI=1S/C7H8Br2N2O2/c1-3-13-7(12)4-5(8)10-11(2)6(4)9/h3H2,1-2H3 |
| InChIKey | HSIBNRIZSHOSIM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.96 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |