C11H16Br2N2O3 — CID 166936948
ethyl 3,5-dibromo-1-(4-hydroxypentyl)pyrazole-4-carboxylate (PubChem CID 166936948) has the molecular formula C11H16Br2N2O3 and a molecular weight of 384.07 g/mol. Its IUPAC name is ethyl 3,5-dibromo-1-(4-hydroxypentyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 3,5-dibromo-1-(4-hydroxypentyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 166936948 |
| Molecular Formula | C11H16Br2N2O3 |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | ethyl 3,5-dibromo-1-(4-hydroxypentyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(Br)nn(CCCC(C)O)c1Br |
| InChI | InChI=1S/C11H16Br2N2O3/c1-3-18-11(17)8-9(12)14-15(10(8)13)6-4-5-7(2)16/h7,16H,3-6H2,1-2H3 |
| InChIKey | VZLJGDLAENPOEC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |