C7H8Br2N2O2 — CID 130115155
ethyl 4,5-dibromo-1-methylimidazole-2-carboxylate (PubChem CID 130115155) has the molecular formula C7H8Br2N2O2 and a molecular weight of 311.96 g/mol. Its IUPAC name is ethyl 4,5-dibromo-1-methylimidazole-2-carboxylate.
| Compound Name | ethyl 4,5-dibromo-1-methylimidazole-2-carboxylate |
|---|---|
| PubChem CID | 130115155 |
| Molecular Formula | C7H8Br2N2O2 |
| Molecular Weight | 311.96 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | ethyl 4,5-dibromo-1-methylimidazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(Br)c(Br)n1C |
| InChI | InChI=1S/C7H8Br2N2O2/c1-3-13-7(12)6-10-4(8)5(9)11(6)2/h3H2,1-2H3 |
| InChIKey | ILBMMSGBNVTSAI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.96 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |