C13H12Br4O5 — CID 19812168
1-O-ethyl 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate (PubChem CID 19812168) has the molecular formula C13H12Br4O5 and a molecular weight of 567.85 g/mol. Its IUPAC name is 1-O-ethyl 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate.
| Compound Name | 1-O-ethyl 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 19812168 |
| Molecular Formula | C13H12Br4O5 |
| Molecular Weight | 567.85 g/mol |
| Exact Mass | 563.74 |
| IUPAC Name | 1-O-ethyl 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)OCC(C)O |
| InChI | InChI=1S/C13H12Br4O5/c1-3-21-12(19)6-7(13(20)22-4-5(2)18)9(15)11(17)10(16)8(6)14/h5,18H,3-4H2,1-2H3 |
| InChIKey | MRUXCGQYNABLBI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|