C26H40Br4Cl3O10P — CID 159789633
2-O-(2-hydroxypropyl) 1-O-(2-propoxyethyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate;methane;tris(1-chloropropan-2-yl) phosphate (PubChem CID 159789633) has the molecular formula C26H40Br4Cl3O10P and a molecular weight of 969.54 g/mol. Its IUPAC name is 2-O-(2-hydroxypropyl) 1-O-(2-propoxyethyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate;methane;tris(1-chloropropan-2-yl) phosphate.
| Compound Name | 2-O-(2-hydroxypropyl) 1-O-(2-propoxyethyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate;methane;tris(1-chloropropan-2-yl) phosphate |
|---|---|
| PubChem CID | 159789633 |
| Molecular Formula | C26H40Br4Cl3O10P |
| Molecular Weight | 969.54 g/mol |
| Exact Mass | 963.82 |
| IUPAC Name | 2-O-(2-hydroxypropyl) 1-O-(2-propoxyethyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate;methane;tris(1-chloropropan-2-yl) phosphate |
| SMILES | C.CC(CCl)OP(=O)(OC(C)CCl)OC(C)CCl.CCCOCCOC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)OCC(C)O |
| InChI | InChI=1S/C16H18Br4O6.C9H18Cl3O4P.CH4/c1-3-4-24-5-6-25-15(22)9-10(16(23)26-7-8(2)21)12(18)14(20)13(19)11(9)17;1-7(4-10)14-17(13,15-8(2)5-11)16-9(3)6-12;/h8,21H,3-7H2,1-2H3;7-9H,4-6H2,1-3H3;1H4 |
| InChIKey | NIJUUYPZQVLNHS-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.54 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|