C14H21BrN4O2 — CID 140700864
ethyl 5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-bromo-1-methylpyrazole-4-carboxylate (PubChem CID 140700864) has the molecular formula C14H21BrN4O2 and a molecular weight of 357.25 g/mol. Its IUPAC name is ethyl 5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-bromo-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-bromo-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 140700864 |
| Molecular Formula | C14H21BrN4O2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | ethyl 5-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-bromo-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(Br)nn(C)c1N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C14H21BrN4O2/c1-3-21-14(20)11-12(15)16-17(2)13(11)19-8-7-18-6-4-5-10(18)9-19/h10H,3-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | RQSRTYCZISTKJJ-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |