C8H13N3O2 — CID 70386750
ethyl 1-amino-3,5-dimethylpyrazole-4-carboxylate (PubChem CID 70386750) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is ethyl 1-amino-3,5-dimethylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-amino-3,5-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 70386750 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | ethyl 1-amino-3,5-dimethylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nn(N)c1C |
| InChI | InChI=1S/C8H13N3O2/c1-4-13-8(12)7-5(2)10-11(9)6(7)3/h4,9H2,1-3H3 |
| InChIKey | WXOUTOVFHVLUKA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |