C9H15ClN4O2 — CID 19382721
ethyl 1-carbamimidoyl-3,5-dimethylpyrazole-4-carboxylate;hydrochloride (PubChem CID 19382721) has the molecular formula C9H15ClN4O2 and a molecular weight of 246.70 g/mol. Its IUPAC name is ethyl 1-carbamimidoyl-3,5-dimethylpyrazole-4-carboxylate;hydrochloride.
| Compound Name | ethyl 1-carbamimidoyl-3,5-dimethylpyrazole-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 19382721 |
| Molecular Formula | C9H15ClN4O2 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | ethyl 1-carbamimidoyl-3,5-dimethylpyrazole-4-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)n1nc(C)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C9H14N4O2.ClH/c1-4-15-8(14)7-5(2)12-13(6(7)3)9(10)11;/h4H2,1-3H3,(H3,10,11);1H |
| InChIKey | WBYRCAHQDVQECT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|