C17H21N3O4 — CID 10664236
diethyl 5-(benzylamino)-3-methylpyrazole-1,4-dicarboxylate (PubChem CID 10664236) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is diethyl 5-(benzylamino)-3-methylpyrazole-1,4-dicarboxylate.
| Compound Name | diethyl 5-(benzylamino)-3-methylpyrazole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 10664236 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | diethyl 5-(benzylamino)-3-methylpyrazole-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)nn(C(=O)OCC)c1NCc1ccccc1 |
| InChI | InChI=1S/C17H21N3O4/c1-4-23-16(21)14-12(3)19-20(17(22)24-5-2)15(14)18-11-13-9-7-6-8-10-13/h6-10,18H,4-5,11H2,1-3H3 |
| InChIKey | JSDUBDFNHQWCBZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |