C24H26N4O4 — CID 15404215
diethyl 3,6-bis(benzylamino)pyrazine-2,5-dicarboxylate (PubChem CID 15404215) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is diethyl 3,6-bis(benzylamino)pyrazine-2,5-dicarboxylate.
| Compound Name | diethyl 3,6-bis(benzylamino)pyrazine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 15404215 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | diethyl 3,6-bis(benzylamino)pyrazine-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1nc(NCc2ccccc2)c(C(=O)OCC)nc1NCc1ccccc1 |
| InChI | InChI=1S/C24H26N4O4/c1-3-31-23(29)19-21(25-15-17-11-7-5-8-12-17)28-20(24(30)32-4-2)22(27-19)26-16-18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3,(H,26,27)(H,25,28) |
| InChIKey | FMWUURDYOISOQB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |