C19H18N4O2 — CID 59517703
ethyl 4-(benzylamino)-2-pyridin-3-ylpyrimidine-5-carboxylate (PubChem CID 59517703) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is ethyl 4-(benzylamino)-2-pyridin-3-ylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(benzylamino)-2-pyridin-3-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 59517703 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | ethyl 4-(benzylamino)-2-pyridin-3-ylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2cccnc2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C19H18N4O2/c1-2-25-19(24)16-13-22-17(15-9-6-10-20-12-15)23-18(16)21-11-14-7-4-3-5-8-14/h3-10,12-13H,2,11H2,1H3,(H,21,22,23) |
| InChIKey | FDKRESJTILXQCO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |