C24H26N4O4S — CID 108775013
ethyl 2-phenyl-4-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]pyrimidine-5-carboxylate (PubChem CID 108775013) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is ethyl 2-phenyl-4-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-phenyl-4-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 108775013 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | ethyl 2-phenyl-4-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccccc2)nc1NCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-2-32-24(29)21-17-26-22(19-8-4-3-5-9-19)27-23(21)25-16-18-10-12-20(13-11-18)33(30,31)28-14-6-7-15-28/h3-5,8-13,17H,2,6-7,14-16H2,1H3,(H,25,26,27) |
| InChIKey | XCRJJXBQYMHNLR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |