C20H26N4O4S — CID 59993233
ethyl 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-4-methylpyrimidine-5-carboxylate (PubChem CID 59993233) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-4-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-4-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 59993233 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-4-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C(C)N2CCN(S(=O)(=O)c3ccccc3)CC2)nc1C |
| InChI | InChI=1S/C20H26N4O4S/c1-4-28-20(25)18-14-21-19(22-15(18)2)16(3)23-10-12-24(13-11-23)29(26,27)17-8-6-5-7-9-17/h5-9,14,16H,4,10-13H2,1-3H3 |
| InChIKey | KMMVYKLCNIRABJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |