C17H24N2O5S2 — CID 9445352
ethyl 2-[(2S)-1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]sulfanylacetate (PubChem CID 9445352) has the molecular formula C17H24N2O5S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethyl 2-[(2S)-1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[(2S)-1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 9445352 |
| Molecular Formula | C17H24N2O5S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | ethyl 2-[(2S)-1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CS[C@@H](C)C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N2O5S2/c1-3-24-16(20)13-25-14(2)17(21)18-9-11-19(12-10-18)26(22,23)15-7-5-4-6-8-15/h4-8,14H,3,9-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | CPIZQMJCDWGQIN-AWEZNQCLSA-N |
| XLogP | 1.20 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |