C21H31N3O5S — CID 45353877
ethyl 1-[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]piperidine-3-carboxylate (PubChem CID 45353877) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is ethyl 1-[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 45353877 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | ethyl 1-[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(C)C(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H31N3O5S/c1-3-29-21(26)18-8-7-11-23(16-18)17(2)20(25)22-12-14-24(15-13-22)30(27,28)19-9-5-4-6-10-19/h4-6,9-10,17-18H,3,7-8,11-16H2,1-2H3 |
| InChIKey | JVCFOTLYRLWUKM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |