C31H24Br2Cl3N3O4 — CID 158248552
ethyl 2-(benzylamino)-6-bromo-4-chloroquinoline-3-carboxylate;ethyl 6-bromo-2,4-dichloroquinoline-3-carboxylate (PubChem CID 158248552) has the molecular formula C31H24Br2Cl3N3O4 and a molecular weight of 768.72 g/mol. Its IUPAC name is ethyl 2-(benzylamino)-6-bromo-4-chloroquinoline-3-carboxylate;ethyl 6-bromo-2,4-dichloroquinoline-3-carboxylate.
| Compound Name | ethyl 2-(benzylamino)-6-bromo-4-chloroquinoline-3-carboxylate;ethyl 6-bromo-2,4-dichloroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 158248552 |
| Molecular Formula | C31H24Br2Cl3N3O4 |
| Molecular Weight | 768.72 g/mol |
| Exact Mass | 764.92 |
| IUPAC Name | ethyl 2-(benzylamino)-6-bromo-4-chloroquinoline-3-carboxylate;ethyl 6-bromo-2,4-dichloroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)nc2ccc(Br)cc2c1Cl.CCOC(=O)c1c(NCc2ccccc2)nc2ccc(Br)cc2c1Cl |
| InChI | InChI=1S/C19H16BrClN2O2.C12H8BrCl2NO2/c1-2-25-19(24)16-17(21)14-10-13(20)8-9-15(14)23-18(16)22-11-12-6-4-3-5-7-12;1-2-18-12(17)9-10(14)7-5-6(13)3-4-8(7)16-11(9)15/h3-10H,2,11H2,1H3,(H,22,23);3-5H,2H2,1H3 |
| InChIKey | GGKUZMNLPRQGGY-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.72 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|