C19H18BrN2O2+ — CID 6973230
ethyl 4-(benzylamino)-6-bromoquinolin-1-ium-3-carboxylate (PubChem CID 6973230) has the molecular formula C19H18BrN2O2+ and a molecular weight of 386.27 g/mol. Its IUPAC name is ethyl 4-(benzylamino)-6-bromoquinolin-1-ium-3-carboxylate.
| Compound Name | ethyl 4-(benzylamino)-6-bromoquinolin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6973230 |
| Molecular Formula | C19H18BrN2O2+ |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | ethyl 4-(benzylamino)-6-bromoquinolin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH+]c2ccc(Br)cc2c1NCc1ccccc1 |
| InChI | InChI=1S/C19H17BrN2O2/c1-2-24-19(23)16-12-21-17-9-8-14(20)10-15(17)18(16)22-11-13-6-4-3-5-7-13/h3-10,12H,2,11H2,1H3,(H,21,22)/p+1 |
| InChIKey | UFPPAGVYFFWERY-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |