C21H22N3O4+ — CID 6972160
diethyl 4-(pyridin-3-ylmethylamino)quinolin-1-ium-3,6-dicarboxylate (PubChem CID 6972160) has the molecular formula C21H22N3O4+ and a molecular weight of 380.42 g/mol. Its IUPAC name is diethyl 4-(pyridin-3-ylmethylamino)quinolin-1-ium-3,6-dicarboxylate.
| Compound Name | diethyl 4-(pyridin-3-ylmethylamino)quinolin-1-ium-3,6-dicarboxylate |
|---|---|
| PubChem CID | 6972160 |
| Molecular Formula | C21H22N3O4+ |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | diethyl 4-(pyridin-3-ylmethylamino)quinolin-1-ium-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2[nH+]cc(C(=O)OCC)c(NCc3cccnc3)c2c1 |
| InChI | InChI=1S/C21H21N3O4/c1-3-27-20(25)15-7-8-18-16(10-15)19(17(13-23-18)21(26)28-4-2)24-12-14-6-5-9-22-11-14/h5-11,13H,3-4,12H2,1-2H3,(H,23,24)/p+1 |
| InChIKey | WTAUIYVTPKXOEJ-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |