C20H21N2O2+ — CID 6929397
ethyl 4-(benzylamino)-6-methylquinolin-1-ium-3-carboxylate (PubChem CID 6929397) has the molecular formula C20H21N2O2+ and a molecular weight of 321.40 g/mol. Its IUPAC name is ethyl 4-(benzylamino)-6-methylquinolin-1-ium-3-carboxylate.
| Compound Name | ethyl 4-(benzylamino)-6-methylquinolin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6929397 |
| Molecular Formula | C20H21N2O2+ |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | ethyl 4-(benzylamino)-6-methylquinolin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH+]c2ccc(C)cc2c1NCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O2/c1-3-24-20(23)17-13-21-18-10-9-14(2)11-16(18)19(17)22-12-15-7-5-4-6-8-15/h4-11,13H,3,12H2,1-2H3,(H,21,22)/p+1 |
| InChIKey | CPNMYVCZFSEIJB-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |