C22H31N3O5+2 — CID 7085234
diethyl 4-(3-morpholin-4-ium-4-ylpropylamino)quinolin-1-ium-3,6-dicarboxylate (PubChem CID 7085234) has the molecular formula C22H31N3O5+2 and a molecular weight of 417.51 g/mol. Its IUPAC name is diethyl 4-(3-morpholin-4-ium-4-ylpropylamino)quinolin-1-ium-3,6-dicarboxylate.
| Compound Name | diethyl 4-(3-morpholin-4-ium-4-ylpropylamino)quinolin-1-ium-3,6-dicarboxylate |
|---|---|
| PubChem CID | 7085234 |
| Molecular Formula | C22H31N3O5+2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | diethyl 4-(3-morpholin-4-ium-4-ylpropylamino)quinolin-1-ium-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2[nH+]cc(C(=O)OCC)c(NCCC[NH+]3CCOCC3)c2c1 |
| InChI | InChI=1S/C22H29N3O5/c1-3-29-21(26)16-6-7-19-17(14-16)20(18(15-24-19)22(27)30-4-2)23-8-5-9-25-10-12-28-13-11-25/h6-7,14-15H,3-5,8-13H2,1-2H3,(H,23,24)/p+2 |
| InChIKey | BJJUFVHGCKETRY-UHFFFAOYSA-P |
| XLogP | 0.72 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|