C22H21ClN2O6 — CID 44659682
4-[[3,6-bis(ethoxycarbonyl)quinolin-1-ium-4-yl]amino]benzoic acid chloride (PubChem CID 44659682) has the molecular formula C22H21ClN2O6 and a molecular weight of 444.87 g/mol. Its IUPAC name is 4-[[3,6-bis(ethoxycarbonyl)quinolin-1-ium-4-yl]amino]benzoic acid chloride.
| Compound Name | 4-[[3,6-bis(ethoxycarbonyl)quinolin-1-ium-4-yl]amino]benzoic acid chloride |
|---|---|
| PubChem CID | 44659682 |
| Molecular Formula | C22H21ClN2O6 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-[[3,6-bis(ethoxycarbonyl)quinolin-1-ium-4-yl]amino]benzoic acid chloride |
| SMILES | CCOC(=O)c1ccc2[nH+]cc(C(=O)OCC)c(Nc3ccc(C(=O)O)cc3)c2c1.[Cl-] |
| InChI | InChI=1S/C22H20N2O6.ClH/c1-3-29-21(27)14-7-10-18-16(11-14)19(17(12-23-18)22(28)30-4-2)24-15-8-5-13(6-9-15)20(25)26;/h5-12H,3-4H2,1-2H3,(H,23,24)(H,25,26);1H |
| InChIKey | SQBTYIVZUPDCFS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |